CAS 128294-46-2 appears in our catalog under these names: (E)-4-(3-Methoxystyryl)phenol, 97%, 4-Hydroxy-3'-methoxystilbene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1000mg, 2000mg, 5000mg, 10000mg.
4-[(E)-2-(3-methoxyphenyl)ethenyl]phenol (CAS 128294-46-2) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 4-[(E)-2-(3-methoxyphenyl)ethenyl]phenol. InChIKey: ZVJLZUWCAUTTBS-AATRIKPKSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 4-[(E)-2-(3-methoxyphenyl)ethenyl]phenol |
| InChIKey | ZVJLZUWCAUTTBS-AATRIKPKSA-N |
| SMILES | COC1=CC=CC(=C1)/C=C/C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)