Products 128303-30-0

CAS 128303-30-0 is the registry number for Tryptophan EP Impurity B (R-Isomer). Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-amino-3-[(3R)-3-hydroxy-2-oxo-1H-indol-3-yl]propanoic acid (CAS 128303-30-0) is a chemical compound with the molecular formula C11H12N2O4 and a molecular weight of 236.22 g/mol. IUPAC name: (2S)-2-amino-3-[(3R)-3-hydroxy-2-oxo-1H-indol-3-yl]propanoic acid. InChIKey: BZRCOYDQHJWPQZ-WRWORJQWSA-N.

Identity
Molecular formulaC11H12N2O4
Molecular weight236.22 g/mol
IUPAC name(2S)-2-amino-3-[(3R)-3-hydroxy-2-oxo-1H-indol-3-yl]propanoic acid
InChIKeyBZRCOYDQHJWPQZ-WRWORJQWSA-N
SMILESC1=CC=C2C(=C1)[C@@](C(=O)N2)(C[C@@H](C(=O)O)N)O

Computed by PubChem (NCBI)