Products 184955-21-3
CAS 184955-21-3 appears in our catalog under these names: (2S)-2-Amino-3-(3-hydroxy-2-oxoindolin-3-yl)propanoic acid (Tryptophan Impurity) (Standard), (2S)-2-Amino-3-(3-hydroxy-2-oxoindolin-3-yl)propanoic acid, Tryptophan Impurity, 98%, Tryptophan EP Impurity B,N-Acetyltryptophan EP Impurity B, Tryptophan EP Impurity B (Mixture of Diastereomers), Dioxindolyl-L-alanine (Mixture of Diastereomers), >95% (HPLC). Offered by: MedChemExpress, Fluorochem, Chemat Brand, TRC, Chemat. Available pack sizes: Get quote, 25mg, 50mg, 100mg, on request, 500mg, 10 mg, 5 mg.
3-(3-hydroxy-2-oxo-2,3-dihydro-1H-indol-3-yl)-L-alanine is an indole-3-acetic acid.
Source: ChEBI
| Molecular formula | C11H12N2O4 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-hydroxy-2-oxo-1H-indol-3-yl)propanoic acid |
| InChIKey | BZRCOYDQHJWPQZ-RGENBBCFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(=O)N2)(C[C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)
Synonyms:
dioxyindolylalanine, Dioxyindolylalanine [EP], Tryptophan impurity B [EP], DIOXYINDOLYLALANINE [EP IMPURITY], TRYPTOPHAN IMPURITY B [EP IMPURITY], (alphaS)-alpha-Amino-2,3-dihydro-3-hydroxy-2-oxo-1H-indole-3-propanoic acid, N-ACETYLTRYPTOPHAN IMPURITY B [EP IMPURITY], DIOXYINDOLYLALANINE (EP IMPURITY), TRYPTOPHAN IMPURITY B (EP IMPURITY), Tryptophan Impurity B