CAS 1283096-75-2 is the registry number for Sitagliptin Impurity 66. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid (CAS 1283096-75-2) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 3-hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid. InChIKey: WHFKHBXZZAXQOD-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 3-hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid |
| InChIKey | WHFKHBXZZAXQOD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)CC(CC(=O)O)O |
Computed by PubChem (NCBI)