CAS 868071-17-4 appears in our catalog under these names: (S)-3-Hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid, 97%, (S)-3-Hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid 97%, (S)-3-Hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 5g, 50mg, 100mg, 250mg, 1g.
(3S)-3-hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid (CAS 868071-17-4) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: (3S)-3-hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid. InChIKey: WHFKHBXZZAXQOD-LURJTMIESA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | (3S)-3-hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid |
| InChIKey | WHFKHBXZZAXQOD-LURJTMIESA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C[C@@H](CC(=O)O)O |
Computed by PubChem (NCBI)