CAS 1283531-62-3 is the registry number for 5-Chloro-2-{((6-methylpyridin-2-yl)methyl)amino}benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-chloro-2-[(6-methyl-2-pyridinyl)methylamino]benzoic acid (CAS 1283531-62-3) is a chemical compound with the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. IUPAC name: 5-chloro-2-[(6-methyl-2-pyridinyl)methylamino]benzoic acid. InChIKey: FFKQYMKMTLTCDZ-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2 |
|---|---|
| Molecular weight | 276.72 g/mol |
| IUPAC name | 5-chloro-2-[(6-methyl-2-pyridinyl)methylamino]benzoic acid |
| InChIKey | FFKQYMKMTLTCDZ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)CNC2=C(C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)