Products 1283531-62-3

CAS 1283531-62-3 is the registry number for 5-Chloro-2-{((6-methylpyridin-2-yl)methyl)amino}benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-chloro-2-[(6-methyl-2-pyridinyl)methylamino]benzoic acid (CAS 1283531-62-3) is a chemical compound with the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. IUPAC name: 5-chloro-2-[(6-methyl-2-pyridinyl)methylamino]benzoic acid. InChIKey: FFKQYMKMTLTCDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13ClN2O2
Molecular weight276.72 g/mol
IUPAC name5-chloro-2-[(6-methyl-2-pyridinyl)methylamino]benzoic acid
InChIKeyFFKQYMKMTLTCDZ-UHFFFAOYSA-N
SMILESCC1=NC(=CC=C1)CNC2=C(C=C(C=C2)Cl)C(=O)O

Computed by PubChem (NCBI)