Products 445468-46-2
CAS 445468-46-2 is the registry number for Deschloro-(S)-efavirenz. Offered by: TRC. Available pack sizes: 100mg.
(4S)-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CAS 445468-46-2) is a chemical compound with the molecular formula C14H10F3NO2 and a molecular weight of 281.23 g/mol. IUPAC name: (4S)-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one. InChIKey: PMAKZVLAJFKTHQ-ZDUSSCGKSA-N.
| Molecular formula | C14H10F3NO2 |
|---|---|
| Molecular weight | 281.23 g/mol |
| IUPAC name | (4S)-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| InChIKey | PMAKZVLAJFKTHQ-ZDUSSCGKSA-N |
| SMILES | C1CC1C#C[C@]2(C3=CC=CC=C3NC(=O)O2)C(F)(F)F |
Computed by PubChem (NCBI)