CAS 128487-44-5 is the registry number for Ethyl 7-fluoroindoline-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 7-fluoro-2,3-dihydro-1H-indole-2-carboxylate (CAS 128487-44-5) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: ethyl 7-fluoro-2,3-dihydro-1H-indole-2-carboxylate. InChIKey: LIWOGGVRGLFUKQ-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO2 |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | ethyl 7-fluoro-2,3-dihydro-1H-indole-2-carboxylate |
| InChIKey | LIWOGGVRGLFUKQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(N1)C(=CC=C2)F |
Computed by PubChem (NCBI)