Products 1285114-10-4
CAS 1285114-10-4 is the registry number for 5-Amino-3-(cyclopentylmethyl)-2,3-dihydro-1,3-benzoxazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-amino-3-(cyclopentylmethyl)-1,3-benzoxazol-2-one (CAS 1285114-10-4) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: 5-amino-3-(cyclopentylmethyl)-1,3-benzoxazol-2-one. InChIKey: ASBAXNXDRLMSIC-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 5-amino-3-(cyclopentylmethyl)-1,3-benzoxazol-2-one |
| InChIKey | ASBAXNXDRLMSIC-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)CN2C3=C(C=CC(=C3)N)OC2=O |
Computed by PubChem (NCBI)