CAS 128550-08-3 appears in our catalog under these names: 1-Boc-3-carboxymethylindole, 95%, 1-BOC-3-CARBOXYMETHYLINDOLE, 97%, 2-(1-(tert-Butoxycarbonyl)-1H-indol-3-yl)acetic acid, 95+%, 2–(1–(tert–butoxycarbonyl)–1H–indol–3–yl)acetic acid. Offered by: Combi-blocks, Fluorochem, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]acetic acid (CAS 128550-08-3) is a chemical compound with the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. IUPAC name: 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]acetic acid. InChIKey: VRZTWLIBIMXVMR-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]acetic acid |
| InChIKey | VRZTWLIBIMXVMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)CC(=O)O |
Computed by PubChem (NCBI)