CAS 1286216-61-2 appears in our catalog under these names: 3-Fluoro-2,6-dimethoxybenzaldehyde, 97%, 3-fluoro-2,6-dimethoxybenzaldehyde, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg.
3-fluoro-2,6-dimethoxybenzaldehyde (CAS 1286216-61-2) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 3-fluoro-2,6-dimethoxybenzaldehyde. InChIKey: QZDKVDNXTNWVEU-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 3-fluoro-2,6-dimethoxybenzaldehyde |
| InChIKey | QZDKVDNXTNWVEU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)OC)C=O |
Computed by PubChem (NCBI)