Products 128822-58-2
CAS 128822-58-2 is the registry number for 2,6-Naphthalenediacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[6-(carboxymethyl)naphthalen-2-yl]acetic acid (CAS 128822-58-2) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 2-[6-(carboxymethyl)naphthalen-2-yl]acetic acid. InChIKey: SEWCZUZXZFNNJR-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 2-[6-(carboxymethyl)naphthalen-2-yl]acetic acid |
| InChIKey | SEWCZUZXZFNNJR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CC(=O)O)C=C1CC(=O)O |
Computed by PubChem (NCBI)