Products 1289007-97-1

CAS 1289007-97-1 is the registry number for 3-Formyl-5-isopropoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-formyl-5-propan-2-yloxybenzoic acid (CAS 1289007-97-1) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 3-formyl-5-propan-2-yloxybenzoic acid. InChIKey: AOAGJROMFCHUJH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O4
Molecular weight208.21 g/mol
IUPAC name3-formyl-5-propan-2-yloxybenzoic acid
InChIKeyAOAGJROMFCHUJH-UHFFFAOYSA-N
SMILESCC(C)OC1=CC(=CC(=C1)C(=O)O)C=O

Computed by PubChem (NCBI)