CAS 1289139-29-2 is the registry number for 3-isopropyl-5-methylsulfanyl-1,6-dihydropyrazolo[4,3-d]pyrimidin-7-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
5-methylsulfanyl-3-propan-2-yl-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one (CAS 1289139-29-2) is a chemical compound with the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. IUPAC name: 5-methylsulfanyl-3-propan-2-yl-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one. InChIKey: DXWAECBRMSCZCM-UHFFFAOYSA-N.
| Molecular formula | C9H12N4OS |
|---|---|
| Molecular weight | 224.29 g/mol |
| IUPAC name | 5-methylsulfanyl-3-propan-2-yl-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one |
| InChIKey | DXWAECBRMSCZCM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2C(=NN1)C(=O)NC(=N2)SC |
Computed by PubChem (NCBI)