CAS 891770-09-5 is the registry number for 2-Amino-5-(3-hydroxypropyl)-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidine-4-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-5-(3-hydroxypropyl)-1,7-dihydropyrrolo[2,3-d]pyrimidine-4-thione (CAS 891770-09-5) is a chemical compound with the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. IUPAC name: 2-amino-5-(3-hydroxypropyl)-1,7-dihydropyrrolo[2,3-d]pyrimidine-4-thione. InChIKey: ZXBBIAKJEWRAMG-UHFFFAOYSA-N.
| Molecular formula | C9H12N4OS |
|---|---|
| Molecular weight | 224.29 g/mol |
| IUPAC name | 2-amino-5-(3-hydroxypropyl)-1,7-dihydropyrrolo[2,3-d]pyrimidine-4-thione |
| InChIKey | ZXBBIAKJEWRAMG-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N1)NC(=NC2=S)N)CCCO |
Computed by PubChem (NCBI)