CAS 955368-93-1 appears in our catalog under these names: 2-isopropyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one, 97%, 97%, 2-Isopropyl-6-methylsulfanyl-1h-pyrazolo[3,4-d]pyrimidin-3-one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
6-methylsulfanyl-2-propan-2-yl-1H-pyrazolo[3,4-d]pyrimidin-3-one (CAS 955368-93-1) is a chemical compound with the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. IUPAC name: 6-methylsulfanyl-2-propan-2-yl-1H-pyrazolo[3,4-d]pyrimidin-3-one. InChIKey: IXDYRENQELLJKX-UHFFFAOYSA-N.
| Molecular formula | C9H12N4OS |
|---|---|
| Molecular weight | 224.29 g/mol |
| IUPAC name | 6-methylsulfanyl-2-propan-2-yl-1H-pyrazolo[3,4-d]pyrimidin-3-one |
| InChIKey | IXDYRENQELLJKX-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2=CN=C(N=C2N1)SC |
Computed by PubChem (NCBI)