CAS 926194-82-3 is the registry number for 2-(Diethylamino)-6H,7H-(1,3)thiazolo(4,5-d)pyrimidin-7-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(diethylamino)-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (CAS 926194-82-3) is a chemical compound with the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. IUPAC name: 2-(diethylamino)-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one. InChIKey: WZPPSCFFPQXAOT-UHFFFAOYSA-N.
| Molecular formula | C9H12N4OS |
|---|---|
| Molecular weight | 224.29 g/mol |
| IUPAC name | 2-(diethylamino)-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| InChIKey | WZPPSCFFPQXAOT-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=NC2=C(S1)C(=O)NC=N2 |
Computed by PubChem (NCBI)