CAS 1951444-73-7 is the registry number for 2-Amino-5-butyl-thiazolo[4,5-d]pyrimidin-7-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-amino-5-butyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (CAS 1951444-73-7) is a chemical compound with the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. IUPAC name: 2-amino-5-butyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one. InChIKey: BSKPPTLOSPPMLG-UHFFFAOYSA-N.
| Molecular formula | C9H12N4OS |
|---|---|
| Molecular weight | 224.29 g/mol |
| IUPAC name | 2-amino-5-butyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| InChIKey | BSKPPTLOSPPMLG-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2=C(C(=O)N1)SC(=N2)N |
Computed by PubChem (NCBI)