Products 1289162-67-9
CAS 1289162-67-9 is the registry number for 4-(Hydroxymethyl)-2-nitrobenzaldehyde, 97%. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
4-(hydroxymethyl)-2-nitrobenzaldehyde (CAS 1289162-67-9) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 4-(hydroxymethyl)-2-nitrobenzaldehyde. InChIKey: BRASIMZCIAXHEX-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 4-(hydroxymethyl)-2-nitrobenzaldehyde |
| InChIKey | BRASIMZCIAXHEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CO)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)