Products 1289209-13-7
CAS 1289209-13-7 is the registry number for 8-Chloro-5,7-dimethylimidazo[1,2-c]pyrimidine, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
8-chloro-5,7-dimethylimidazo[1,2-c]pyrimidine (CAS 1289209-13-7) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 8-chloro-5,7-dimethylimidazo[1,2-c]pyrimidine. InChIKey: NKSKVZNPYSYLSM-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 8-chloro-5,7-dimethylimidazo[1,2-c]pyrimidine |
| InChIKey | NKSKVZNPYSYLSM-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC=CN2C(=N1)C)Cl |
Computed by PubChem (NCBI)