Products 1289646-90-7
CAS 1289646-90-7 appears in our catalog under these names: Lifitegrast Impurity 32, Lifitegrast Impurity 37, Ethyl benzofuran-6-carboxylate, 98%, Ethyl benzofuran-6-carboxylate, 97%, 97%, Ethyl benzofuran-6-carboxylate, 97%. Offered by: Chemat Brand, AmBeed, Chemat, Fluorochem. Available pack sizes: on request, 5g, 10g, 100mg, 250mg, 1g.
Ethyl 1-benzofuran-6-carboxylate (CAS 1289646-90-7) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: ethyl 1-benzofuran-6-carboxylate. InChIKey: ZHSUYHAYEKFIBQ-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | ethyl 1-benzofuran-6-carboxylate |
| InChIKey | ZHSUYHAYEKFIBQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C=CO2 |
Computed by PubChem (NCBI)