Products 1291053-38-7
CAS 1291053-38-7 appears in our catalog under these names: Evodosin A, Evodosin A, 96.0%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
7-hydroxy-3-(1,2,3-trihydroxy-3-methylbutyl)chromen-2-one (CAS 1291053-38-7) is a chemical compound with the molecular formula C14H16O6 and a molecular weight of 280.27 g/mol. IUPAC name: 7-hydroxy-3-(1,2,3-trihydroxy-3-methylbutyl)chromen-2-one. InChIKey: UWTSEUOPXSZNNG-UHFFFAOYSA-N.
| Molecular formula | C14H16O6 |
|---|---|
| Molecular weight | 280.27 g/mol |
| IUPAC name | 7-hydroxy-3-(1,2,3-trihydroxy-3-methylbutyl)chromen-2-one |
| InChIKey | UWTSEUOPXSZNNG-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C(C1=CC2=C(C=C(C=C2)O)OC1=O)O)O)O |
Computed by PubChem (NCBI)