Products 80081-75-0

CAS 80081-75-0 is the registry number for Ethyl 4-(2,4-dimethoxyphenyl)-2,4-dioxobutanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 4-(2,4-dimethoxyphenyl)-2,4-dioxobutanoate (CAS 80081-75-0) is a chemical compound with the molecular formula C14H16O6 and a molecular weight of 280.27 g/mol. IUPAC name: ethyl 4-(2,4-dimethoxyphenyl)-2,4-dioxobutanoate. InChIKey: BEWULQFJCCQQIU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16O6
Molecular weight280.27 g/mol
IUPAC nameethyl 4-(2,4-dimethoxyphenyl)-2,4-dioxobutanoate
InChIKeyBEWULQFJCCQQIU-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)CC(=O)C1=C(C=C(C=C1)OC)OC

Computed by PubChem (NCBI)