Products 70909-46-5

CAS 70909-46-5 is the registry number for Ethyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate (CAS 70909-46-5) is a chemical compound with the molecular formula C14H16O6 and a molecular weight of 280.27 g/mol. IUPAC name: ethyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate. InChIKey: QKDCYXNBYBQHTI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16O6
Molecular weight280.27 g/mol
IUPAC nameethyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate
InChIKeyQKDCYXNBYBQHTI-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)CC(=O)C1=CC(=C(C=C1)OC)OC

Computed by PubChem (NCBI)