Products 151636-98-5
CAS 151636-98-5 is the registry number for Zhebeiresinol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,3aS,6aS)-3-(4-hydroxy-3,5-dimethoxyphenyl)-3,3a,4,6a-tetrahydro-1H-furo[3,4-c]furan-6-one (CAS 151636-98-5) is a chemical compound with the molecular formula C14H16O6 and a molecular weight of 280.27 g/mol. IUPAC name: (3R,3aS,6aS)-3-(4-hydroxy-3,5-dimethoxyphenyl)-3,3a,4,6a-tetrahydro-1H-furo[3,4-c]furan-6-one. InChIKey: AUXYOVQIZNPKSO-KKFJDGPESA-N.
| Molecular formula | C14H16O6 |
|---|---|
| Molecular weight | 280.27 g/mol |
| IUPAC name | (3R,3aS,6aS)-3-(4-hydroxy-3,5-dimethoxyphenyl)-3,3a,4,6a-tetrahydro-1H-furo[3,4-c]furan-6-one |
| InChIKey | AUXYOVQIZNPKSO-KKFJDGPESA-N |
| SMILES | COC1=CC(=CC(=C1O)OC)[C@H]2[C@@H]3COC(=O)[C@@H]3CO2 |
Computed by PubChem (NCBI)