CAS 84-72-0 appears in our catalog under these names: Ethyl phthalyl ethyl glycolate, 95%, Ethyl Phthalyl Ethyl Glycolate, >95% (GC), Ethylphthalylethylglycolate, 98%, Phthalic acid, ethyl ester-(ethyl glycolate), Ethyl Phthalyl Ethyl Glycolate. Offered by: Combi-blocks, TRC, AmBeed, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 25g, 500g, 100g, 1kg, 5g, 2,5g, 250mg, 500mg.
2-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl benzene-1,2-dicarboxylate (CAS 84-72-0) is a chemical compound with the molecular formula C14H16O6 and a molecular weight of 280.27 g/mol. IUPAC name: 2-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl benzene-1,2-dicarboxylate. InChIKey: PZBLUWVMZMXIKZ-UHFFFAOYSA-N.
| Molecular formula | C14H16O6 |
|---|---|
| Molecular weight | 280.27 g/mol |
| IUPAC name | 2-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl benzene-1,2-dicarboxylate |
| InChIKey | PZBLUWVMZMXIKZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC(=O)C1=CC=CC=C1C(=O)OCC |
Computed by PubChem (NCBI)