CAS 1291160-19-4 is the registry number for 3-(Pyrrolidine-2-carboxamido)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(pyrrolidine-2-carbonylamino)benzoic acid (CAS 1291160-19-4) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: 3-(pyrrolidine-2-carbonylamino)benzoic acid. InChIKey: HMZQASVDGDUUMS-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 3-(pyrrolidine-2-carbonylamino)benzoic acid |
| InChIKey | HMZQASVDGDUUMS-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C(=O)NC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)