CAS 724700-26-9 appears in our catalog under these names: Ertapenem Impurity Pro-maba, Ertapenem Impurity 16, Ertapenem Impurity 11, 3-(((2S)-2-Pyrrolidinylcarbonyl)amino)benzoic Acid, >95% (HPLC), 3-[[(2S)-2-Pyrrolidinylcarbonyl]amino]benzoic Acid, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 500mg.
3-[[(2S)-pyrrolidine-2-carbonyl]amino]benzoic acid (CAS 724700-26-9) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: 3-[[(2S)-pyrrolidine-2-carbonyl]amino]benzoic acid. InChIKey: HMZQASVDGDUUMS-JTQLQIEISA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 3-[[(2S)-pyrrolidine-2-carbonyl]amino]benzoic acid |
| InChIKey | HMZQASVDGDUUMS-JTQLQIEISA-N |
| SMILES | C1C[C@H](NC1)C(=O)NC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)