CAS 1291487-11-0 is the registry number for 3-Methyl-n-(3-methylphenyl)[1,2,4]triazolo[4,3-a]pyridine-8-sulfonamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-methyl-N-(3-methylphenyl)-[1,2,4]triazolo[4,3-a]pyridine-8-sulfonamide (CAS 1291487-11-0) is a chemical compound with the molecular formula C14H14N4O2S and a molecular weight of 302.35 g/mol. IUPAC name: 3-methyl-N-(3-methylphenyl)-[1,2,4]triazolo[4,3-a]pyridine-8-sulfonamide. InChIKey: XWHJQBBVGTVLDK-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O2S |
|---|---|
| Molecular weight | 302.35 g/mol |
| IUPAC name | 3-methyl-N-(3-methylphenyl)-[1,2,4]triazolo[4,3-a]pyridine-8-sulfonamide |
| InChIKey | XWHJQBBVGTVLDK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NS(=O)(=O)C2=CC=CN3C2=NN=C3C |
Computed by PubChem (NCBI)