CAS 2758411-46-8 appears in our catalog under these names: DC-BPi-03, 98%, DC-BPi-03/ 98.96% (existing batch purity), DC–BPi–03, DC-BPi-03 99%, 6-(1H-Indol-5-yl)-N-methyl-2-(methylsulfonyl)-4-pyrimidinamine, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL.
6-(1H-indol-5-yl)-N-methyl-2-methylsulfonylpyrimidin-4-amine (CAS 2758411-46-8) is a chemical compound with the molecular formula C14H14N4O2S and a molecular weight of 302.35 g/mol. IUPAC name: 6-(1H-indol-5-yl)-N-methyl-2-methylsulfonylpyrimidin-4-amine. InChIKey: RTONKOFFKFVXAW-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O2S |
|---|---|
| Molecular weight | 302.35 g/mol |
| IUPAC name | 6-(1H-indol-5-yl)-N-methyl-2-methylsulfonylpyrimidin-4-amine |
| InChIKey | RTONKOFFKFVXAW-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=NC(=C1)C2=CC3=C(C=C2)NC=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)