Products 1612755-71-1
CAS 1612755-71-1 appears in our catalog under these names: PF–06260414, PF-06260414. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 50mg, 25mg, 100mg.
6-[(4R)-4-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl]isoquinoline-1-carbonitrile (CAS 1612755-71-1) is a chemical compound with the molecular formula C14H14N4O2S and a molecular weight of 302.35 g/mol. IUPAC name: 6-[(4R)-4-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl]isoquinoline-1-carbonitrile. InChIKey: ZKAVFOXYJCREBQ-SNVBAGLBSA-N.
| Molecular formula | C14H14N4O2S |
|---|---|
| Molecular weight | 302.35 g/mol |
| IUPAC name | 6-[(4R)-4-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl]isoquinoline-1-carbonitrile |
| InChIKey | ZKAVFOXYJCREBQ-SNVBAGLBSA-N |
| SMILES | C[C@@H]1CNS(=O)(=O)N(C1)C2=CC3=C(C=C2)C(=NC=C3)C#N |
Computed by PubChem (NCBI)