CAS 2071708-56-8 is the registry number for 1-Tosyl-1H-pyrrolo[2,3-b]pyridine-4,5-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-4,5-diamine (CAS 2071708-56-8) is a chemical compound with the molecular formula C14H14N4O2S and a molecular weight of 302.35 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-4,5-diamine. InChIKey: VTCRLVIWSKAVHC-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O2S |
|---|---|
| Molecular weight | 302.35 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-4,5-diamine |
| InChIKey | VTCRLVIWSKAVHC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(C(=CN=C32)N)N |
Computed by PubChem (NCBI)