CAS 910789-32-1 is the registry number for N-Methyl-7-tosyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-methyl-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine (CAS 910789-32-1) is a chemical compound with the molecular formula C14H14N4O2S and a molecular weight of 302.35 g/mol. IUPAC name: N-methyl-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: LNQFBIWLEOUSTE-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O2S |
|---|---|
| Molecular weight | 302.35 g/mol |
| IUPAC name | N-methyl-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | LNQFBIWLEOUSTE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(N=CN=C32)NC |
Computed by PubChem (NCBI)