Products 1291487-28-9
CAS 1291487-28-9 is the registry number for Dimethyl 2-(5-bromopyrimidin-2-yl)malonate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
Dimethyl 2-(5-bromopyrimidin-2-yl)propanedioate (CAS 1291487-28-9) is a chemical compound with the molecular formula C9H9BrN2O4 and a molecular weight of 289.08 g/mol. IUPAC name: dimethyl 2-(5-bromopyrimidin-2-yl)propanedioate. InChIKey: YXNZSTOSBATLOU-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O4 |
|---|---|
| Molecular weight | 289.08 g/mol |
| IUPAC name | dimethyl 2-(5-bromopyrimidin-2-yl)propanedioate |
| InChIKey | YXNZSTOSBATLOU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=NC=C(C=N1)Br)C(=O)OC |
Computed by PubChem (NCBI)