Products 2377920-19-7
CAS 2377920-19-7 is the registry number for 2-(2-Bromo-4-nitrophenoxy)-N-methylacetamide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2-bromo-4-nitrophenoxy)-N-methylacetamide (CAS 2377920-19-7) is a chemical compound with the molecular formula C9H9BrN2O4 and a molecular weight of 289.08 g/mol. IUPAC name: 2-(2-bromo-4-nitrophenoxy)-N-methylacetamide. InChIKey: BZTLBQLSMLSBSZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O4 |
|---|---|
| Molecular weight | 289.08 g/mol |
| IUPAC name | 2-(2-bromo-4-nitrophenoxy)-N-methylacetamide |
| InChIKey | BZTLBQLSMLSBSZ-UHFFFAOYSA-N |
| SMILES | CNC(=O)COC1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)