Products 258508-84-8
CAS 258508-84-8 is the registry number for Methyl 2-amino-5-bromo-6-methyl-3-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-amino-5-bromo-6-methyl-3-nitrobenzoate (CAS 258508-84-8) is a chemical compound with the molecular formula C9H9BrN2O4 and a molecular weight of 289.08 g/mol. IUPAC name: methyl 2-amino-5-bromo-6-methyl-3-nitrobenzoate. InChIKey: ZFRYNZHYOPDFNK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O4 |
|---|---|
| Molecular weight | 289.08 g/mol |
| IUPAC name | methyl 2-amino-5-bromo-6-methyl-3-nitrobenzoate |
| InChIKey | ZFRYNZHYOPDFNK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1C(=O)OC)N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)