CAS 2782818-87-3 is the registry number for Methyl 2-bromo-5-(methylamino)-4-nitrobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-bromo-5-(methylamino)-4-nitrobenzoate (CAS 2782818-87-3) is a chemical compound with the molecular formula C9H9BrN2O4 and a molecular weight of 289.08 g/mol. IUPAC name: methyl 2-bromo-5-(methylamino)-4-nitrobenzoate. InChIKey: GOPYXUFTNIJSCX-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O4 |
|---|---|
| Molecular weight | 289.08 g/mol |
| IUPAC name | methyl 2-bromo-5-(methylamino)-4-nitrobenzoate |
| InChIKey | GOPYXUFTNIJSCX-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C(=C1)C(=O)OC)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)