Products 1363382-04-0
CAS 1363382-04-0 appears in our catalog under these names: Ethyl 3-bromo-5-nitropyridine-4-acetate, 95%, Ethyl 2-(3-bromo-5-nitropyridin-4-yl)acetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
Ethyl 2-(3-bromo-5-nitro-4-pyridinyl)acetate (CAS 1363382-04-0) is a chemical compound with the molecular formula C9H9BrN2O4 and a molecular weight of 289.08 g/mol. IUPAC name: ethyl 2-(3-bromo-5-nitro-4-pyridinyl)acetate. InChIKey: RAFZKGHGDIHWKS-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O4 |
|---|---|
| Molecular weight | 289.08 g/mol |
| IUPAC name | ethyl 2-(3-bromo-5-nitro-4-pyridinyl)acetate |
| InChIKey | RAFZKGHGDIHWKS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=NC=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)