CAS 129192-19-4 appears in our catalog under these names: 3-amino-5-(4-carboxyphenyl)benzoicacid, 98%, 98%, 5-Amino-[1,1'-biphenyl]-3,4'-dicarboxylic acid, 98%, 5-Amino[1,1′-biphenyl]-3,4′-dicarboxylic acid, 98%. Offered by: Chemat, Chemat Brand, Fluorochem, Ambeed. Available pack sizes: 250mg, on request, 100mg, 1g.
3-amino-5-(4-carboxyphenyl)benzoic acid (CAS 129192-19-4) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 3-amino-5-(4-carboxyphenyl)benzoic acid. InChIKey: GSGCVRDFHWTJJX-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-amino-5-(4-carboxyphenyl)benzoic acid |
| InChIKey | GSGCVRDFHWTJJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)N)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)