Products 1292306-23-0

CAS 1292306-23-0 is the registry number for tert-Butyl 2-oxo-2H-spiro[benzofuran-3,4'-piperidine]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 2-oxospiro[1-benzofuran-3,4'-piperidine]-1'-carboxylate (CAS 1292306-23-0) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: tert-butyl 2-oxospiro[1-benzofuran-3,4'-piperidine]-1'-carboxylate. InChIKey: LHANULHYECCYLN-UHFFFAOYSA-N.

Identity
Molecular formulaC17H21NO4
Molecular weight303.35 g/mol
IUPAC nametert-butyl 2-oxospiro[1-benzofuran-3,4'-piperidine]-1'-carboxylate
InChIKeyLHANULHYECCYLN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CC1)C3=CC=CC=C3OC2=O

Computed by PubChem (NCBI)