Products 1292317-52-2
CAS 1292317-52-2 is the registry number for 2-Cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate (CAS 1292317-52-2) is a chemical compound with the molecular formula C15H18BNO4 and a molecular weight of 287.12 g/mol. IUPAC name: [2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate. InChIKey: ZIXXOCCEBUWGGH-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO4 |
|---|---|
| Molecular weight | 287.12 g/mol |
| IUPAC name | [2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate |
| InChIKey | ZIXXOCCEBUWGGH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC(=O)C)C#N |
Computed by PubChem (NCBI)