CAS 862081-47-8 is the registry number for 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoindoline-1,3-dione, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoindole-1,3-dione (CAS 862081-47-8) is a chemical compound with the molecular formula C15H18BNO4 and a molecular weight of 287.12 g/mol. IUPAC name: 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoindole-1,3-dione. InChIKey: WUPJVNRWPHBSCL-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO4 |
|---|---|
| Molecular weight | 287.12 g/mol |
| IUPAC name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoindole-1,3-dione |
| InChIKey | WUPJVNRWPHBSCL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C(=O)N(C3=O)C |
Computed by PubChem (NCBI)