CAS 294852-07-6 is the registry number for 4-(t-Butoxycarbonylamino)naphthalene-1-boronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[4-[(2-methylpropan-2-yl)oxycarbonylamino]naphthalen-1-yl]boronic acid (CAS 294852-07-6) is a chemical compound with the molecular formula C15H18BNO4 and a molecular weight of 287.12 g/mol. IUPAC name: [4-[(2-methylpropan-2-yl)oxycarbonylamino]naphthalen-1-yl]boronic acid. InChIKey: OGMYIGRGJGXLLH-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO4 |
|---|---|
| Molecular weight | 287.12 g/mol |
| IUPAC name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]naphthalen-1-yl]boronic acid |
| InChIKey | OGMYIGRGJGXLLH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C2=CC=CC=C12)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)