Products 2098428-04-5
CAS 2098428-04-5 is the registry number for 2-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylic acid (CAS 2098428-04-5) is a chemical compound with the molecular formula C15H18BNO4 and a molecular weight of 287.12 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylic acid. InChIKey: TVIIOWIRLZCWEF-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO4 |
|---|---|
| Molecular weight | 287.12 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylic acid |
| InChIKey | TVIIOWIRLZCWEF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)