Products 2828431-91-8
CAS 2828431-91-8 is the registry number for 3-Amino-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-chromen-2-one, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
3-amino-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one (CAS 2828431-91-8) is a chemical compound with the molecular formula C15H18BNO4 and a molecular weight of 287.12 g/mol. IUPAC name: 3-amino-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one. InChIKey: YEVPAKMGNGCEMF-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO4 |
|---|---|
| Molecular weight | 287.12 g/mol |
| IUPAC name | 3-amino-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one |
| InChIKey | YEVPAKMGNGCEMF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=C(C(=O)O3)N |
Computed by PubChem (NCBI)