Products 129277-03-8
CAS 129277-03-8 is the registry number for Boscialin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
(E)-4-[(1S,4S,6R)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one (CAS 129277-03-8) is a chemical compound with the molecular formula C13H22O3 and a molecular weight of 226.31 g/mol. IUPAC name: (E)-4-[(1S,4S,6R)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one. InChIKey: CWLKAPCFJXJCEO-SGEPYOGPSA-N.
| Molecular formula | C13H22O3 |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | (E)-4-[(1S,4S,6R)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one |
| InChIKey | CWLKAPCFJXJCEO-SGEPYOGPSA-N |
| SMILES | C[C@@H]1C[C@@H](CC([C@]1(/C=C/C(=O)C)O)(C)C)O |
Computed by PubChem (NCBI)