Products 1292906-91-2
CAS 1292906-91-2 is the registry number for (S)-Metoprolol-d7. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
(2S)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol (CAS 1292906-91-2) is a chemical compound with the molecular formula C15H25NO3 and a molecular weight of 274.41 g/mol. IUPAC name: (2S)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol. InChIKey: IUBSYMUCCVWXPE-BDVYYODNSA-N.
| Molecular formula | C15H25NO3 |
|---|---|
| Molecular weight | 274.41 g/mol |
| IUPAC name | (2S)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol |
| InChIKey | IUBSYMUCCVWXPE-BDVYYODNSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC[C@@H](COC1=CC=C(C=C1)CCOC)O |
Computed by PubChem (NCBI)