CAS 96849-43-3 is the registry number for Metoprolol-d6. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol (CAS 96849-43-3) is a chemical compound with the molecular formula C15H25NO3 and a molecular weight of 273.40 g/mol. IUPAC name: 1-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol. InChIKey: IUBSYMUCCVWXPE-WFGJKAKNSA-N.
| Molecular formula | C15H25NO3 |
|---|---|
| Molecular weight | 273.40 g/mol |
| IUPAC name | 1-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol |
| InChIKey | IUBSYMUCCVWXPE-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])NCC(COC1=CC=C(C=C1)CCOC)O |
Computed by PubChem (NCBI)