Products 959787-96-3
CAS 959787-96-3 appears in our catalog under these names: rac Metoprolol-d7, >95% (HPLC), rac Metoprolol-d7, METOPROLOL-(ISOPROPYL-D7) (+)-TARTRA, Metoprolol-d7, 98.81%. Offered by: TRC, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 50mg, 1 mg.
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol (CAS 959787-96-3) is a chemical compound with the molecular formula C15H25NO3 and a molecular weight of 274.41 g/mol. IUPAC name: 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol. InChIKey: IUBSYMUCCVWXPE-QLWPOVNFSA-N.
| Molecular formula | C15H25NO3 |
|---|---|
| Molecular weight | 274.41 g/mol |
| IUPAC name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol |
| InChIKey | IUBSYMUCCVWXPE-QLWPOVNFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=C(C=C1)CCOC)O |
Computed by PubChem (NCBI)