Products 1292907-84-6
CAS 1292907-84-6 appears in our catalog under these names: (R)-Metoprolol-d7, >95% (HPLC), (R)-Metoprolol-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
(2R)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol (CAS 1292907-84-6) is a chemical compound with the molecular formula C15H25NO3 and a molecular weight of 274.41 g/mol. IUPAC name: (2R)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol. InChIKey: IUBSYMUCCVWXPE-ZOUKVZROSA-N.
| Molecular formula | C15H25NO3 |
|---|---|
| Molecular weight | 274.41 g/mol |
| IUPAC name | (2R)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol |
| InChIKey | IUBSYMUCCVWXPE-ZOUKVZROSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC[C@H](COC1=CC=C(C=C1)CCOC)O |
Computed by PubChem (NCBI)